C26H29NO3 — CID 155551511
1-(heptoxymethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 155551511) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is 1-(heptoxymethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 1-(heptoxymethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 155551511 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 1-(heptoxymethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CCCCCCCOCC12c3ccccc3C(c3ccccc31)C1C(=O)NC(=O)C12 |
| InChI | InChI=1S/C26H29NO3/c1-2-3-4-5-10-15-30-16-26-19-13-8-6-11-17(19)21(18-12-7-9-14-20(18)26)22-23(26)25(29)27-24(22)28/h6-9,11-14,21-23H,2-5,10,15-16H2,1H3,(H,27,28,29) |
| InChIKey | GJAXQWMETRTSDF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|