C29H38BFO8 — CID 155551636
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3,10-dihydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate (PubChem CID 155551636) has the molecular formula C29H38BFO8 and a molecular weight of 544.43 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3,10-dihydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3,10-dihydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate |
|---|---|
| PubChem CID | 155551636 |
| Molecular Formula | C29H38BFO8 |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3,10-dihydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)COc2ccc3c(c2F)B(O)OC3)[C@]2(C)[C@H](C)CC[C@]3(CC(O)C(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C29H38BFO8/c1-6-27(4)12-20(39-21(33)14-37-19-8-7-17-13-38-30(36)22(17)23(19)31)28(5)15(2)9-10-29(16(3)26(27)35)11-18(32)24(34)25(28)29/h6-8,15-16,18,20,25-26,32,35-36H,1,9-14H2,2-5H3/t15-,16+,18?,20-,25+,26+,27-,28+,29+/m1/s1 |
| InChIKey | SNHXERVYHQEROI-GXQJDTGBSA-N |
| XLogP | 2.30 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|