C25H21N3O2 — CID 155551706
(E)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-3-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enamide (PubChem CID 155551706) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is (E)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-3-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enamide.
| Compound Name | (E)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-3-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 155551706 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (E)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-3-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cnc2[nH]cc(-c3ccccc3)c2c1)NCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C25H21N3O2/c29-24(26-14-17-6-8-23-20(12-17)10-11-30-23)9-7-18-13-21-22(16-28-25(21)27-15-18)19-4-2-1-3-5-19/h1-9,12-13,15-16H,10-11,14H2,(H,26,29)(H,27,28)/b9-7+ |
| InChIKey | GGPYXPUQPJETOE-VQHVLOKHSA-N |
| XLogP | 4.49 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|