About 2-phenylsulfanylhexanoic acid
2-phenylsulfanylhexanoic acid (PubChem CID 15555176) has the molecular formula C12H16O2S
and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-phenylsulfanylhexanoic acid.
Molecular Properties
| Compound Name | 2-phenylsulfanylhexanoic acid |
| PubChem CID | 15555176 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-phenylsulfanylhexanoic acid |
| SMILES | CCCCC(Sc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H16O2S/c1-2-3-9-11(12(13)14)15-10-7-5-4-6-8-10/h4-8,11H,2-3,9H2,1H3,(H,13,14) |
| InChIKey | DKRRYMSLPPVGRB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylsulfanylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylhexanoic acid?
The IUPAC name of 2-phenylsulfanylhexanoic acid (CID 15555176) is 2-phenylsulfanylhexanoic acid.
What is the SMILES notation for 2-phenylsulfanylhexanoic acid?
The canonical SMILES for 2-phenylsulfanylhexanoic acid is CCCCC(Sc1ccccc1)C(=O)O.
What is the InChIKey of 2-phenylsulfanylhexanoic acid?
The InChIKey is DKRRYMSLPPVGRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2S/c1-2-3-9-11(12(13)14)15-10-7-5-4-6-8-10/h4-8,11H,2-3,9H2,1H3,(H,13,14).
What are the key properties of 2-phenylsulfanylhexanoic acid?
2-phenylsulfanylhexanoic acid has a molecular weight of 224.33 g/mol, XLogP of 3.42, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylhexanoic acid is sourced from PubChem (CID 15555176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).