C33H37NO12 — CID 155551774
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[3-hydroxy-1-[(3-methylphenyl)methyl]-2-oxoindol-3-yl]-2-oxopropyl]oxan-2-yl]methyl acetate (PubChem CID 155551774) has the molecular formula C33H37NO12 and a molecular weight of 639.65 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[3-hydroxy-1-[(3-methylphenyl)methyl]-2-oxoindol-3-yl]-2-oxopropyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[3-hydroxy-1-[(3-methylphenyl)methyl]-2-oxoindol-3-yl]-2-oxopropyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155551774 |
| Molecular Formula | C33H37NO12 |
| Molecular Weight | 639.65 g/mol |
| Exact Mass | 639.23 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[3-hydroxy-1-[(3-methylphenyl)methyl]-2-oxoindol-3-yl]-2-oxopropyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](CC(=O)CC2(O)C(=O)N(Cc3cccc(C)c3)c3ccccc32)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H37NO12/c1-18-9-8-10-23(13-18)16-34-26-12-7-6-11-25(26)33(41,32(34)40)15-24(39)14-27-29(43-20(3)36)31(45-22(5)38)30(44-21(4)37)28(46-27)17-42-19(2)35/h6-13,27-31,41H,14-17H2,1-5H3/t27-,28+,29-,30+,31+,33?/m0/s1 |
| InChIKey | LPFUMUHHEPUKCQ-YZJAFSEOSA-N |
| XLogP | 2.20 |
| TPSA | 172.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.65 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|