About 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile
2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile (PubChem CID 155551796) has the molecular formula C14H10F3N3O2S
and a molecular weight of 341.31 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile |
| PubChem CID | 155551796 |
| Molecular Formula | C14H10F3N3O2S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile |
| SMILES | COc1cc(OC)nc(Sc2ccc(C(F)(F)F)cc2C#N)n1 |
| InChI | InChI=1S/C14H10F3N3O2S/c1-21-11-6-12(22-2)20-13(19-11)23-10-4-3-9(14(15,16)17)5-8(10)7-18/h3-6H,1-2H3 |
| InChIKey | VNLVHHQJCTULKF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile?
The IUPAC name of 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile (CID 155551796) is 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile?
The canonical SMILES for 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile is COc1cc(OC)nc(Sc2ccc(C(F)(F)F)cc2C#N)n1.
What is the InChIKey of 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile?
The InChIKey is VNLVHHQJCTULKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3N3O2S/c1-21-11-6-12(22-2)20-13(19-11)23-10-4-3-9(14(15,16)17)5-8(10)7-18/h3-6H,1-2H3.
What are the key properties of 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile?
2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile has a molecular weight of 341.31 g/mol, XLogP of 3.54, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-5-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 155551796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).