C27H32ClN7O2 — CID 155551825
(3S,8R,9S,10R,13S,14S,16S)-16-[4-[(6-chloropurin-9-yl)methyl]triazol-1-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 155551825) has the molecular formula C27H32ClN7O2 and a molecular weight of 522.05 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,16S)-16-[4-[(6-chloropurin-9-yl)methyl]triazol-1-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,8R,9S,10R,13S,14S,16S)-16-[4-[(6-chloropurin-9-yl)methyl]triazol-1-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 155551825 |
| Molecular Formula | C27H32ClN7O2 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,16S)-16-[4-[(6-chloropurin-9-yl)methyl]triazol-1-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)[C@@H](n3cc(Cn4cnc5c(Cl)ncnc54)nn3)C[C@@H]12 |
| InChI | InChI=1S/C27H32ClN7O2/c1-26-7-5-17(36)9-15(26)3-4-18-19(26)6-8-27(2)20(18)10-21(23(27)37)35-12-16(32-33-35)11-34-14-31-22-24(28)29-13-30-25(22)34/h3,12-14,17-21,36H,4-11H2,1-2H3/t17-,18+,19-,20-,21-,26-,27-/m0/s1 |
| InChIKey | DSUQGGIEFUZHCP-LHCFXBJASA-N |
| XLogP | 4.16 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|