C20H38N6O6 — CID 155551887
(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoyl]amino]pentanoic acid (PubChem CID 155551887) has the molecular formula C20H38N6O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 155551887 |
| Molecular Formula | C20H38N6O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H38N6O6/c1-11(2)10-14(26-19(31)32-20(4,5)6)16(28)24-12(3)15(27)25-13(17(29)30)8-7-9-23-18(21)22/h11-14H,7-10H2,1-6H3,(H,24,28)(H,25,27)(H,26,31)(H,29,30)(H4,21,22,23)/t12-,13-,14-/m0/s1 |
| InChIKey | UOVQWLYFNOENRL-IHRRRGAJSA-N |
| XLogP | 0.05 |
| TPSA | 198.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|