About 5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one
5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one (PubChem CID 155552050) has the molecular formula C15H11Cl2NO2
and a molecular weight of 308.16 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one |
| PubChem CID | 155552050 |
| Molecular Formula | C15H11Cl2NO2 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(OCc3ccc(Cl)c(Cl)c3)ccc2N1 |
| InChI | InChI=1S/C15H11Cl2NO2/c16-12-3-1-9(5-13(12)17)8-20-11-2-4-14-10(6-11)7-15(19)18-14/h1-6H,7-8H2,(H,18,19) |
| InChIKey | ZWPPLIGPPCMGHT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one?
The IUPAC name of 5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one (CID 155552050) is 5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one?
The canonical SMILES for 5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one is O=C1Cc2cc(OCc3ccc(Cl)c(Cl)c3)ccc2N1.
What is the InChIKey of 5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one?
The InChIKey is ZWPPLIGPPCMGHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2NO2/c16-12-3-1-9(5-13(12)17)8-20-11-2-4-14-10(6-11)7-15(19)18-14/h1-6H,7-8H2,(H,18,19).
What are the key properties of 5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one?
5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one has a molecular weight of 308.16 g/mol, XLogP of 4.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-dichlorophenyl)methoxy]-1,3-dihydroindol-2-one is sourced from PubChem (CID 155552050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).