About 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide (PubChem CID 155552084) has the molecular formula C21H21N3O2S2
and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide.
Molecular Properties
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide |
| PubChem CID | 155552084 |
| Molecular Formula | C21H21N3O2S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide |
| SMILES | COc1cccc(Sc2ccc(NC(=O)CSc3nc(C)cc(C)n3)cc2)c1 |
| InChI | InChI=1S/C21H21N3O2S2/c1-14-11-15(2)23-21(22-14)27-13-20(25)24-16-7-9-18(10-8-16)28-19-6-4-5-17(12-19)26-3/h4-12H,13H2,1-3H3,(H,24,25) |
| InChIKey | PTFNAVCVYOASHT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide?
The IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide (CID 155552084) is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide.
What is the SMILES notation for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide?
The canonical SMILES for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide is COc1cccc(Sc2ccc(NC(=O)CSc3nc(C)cc(C)n3)cc2)c1.
What is the InChIKey of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide?
The InChIKey is PTFNAVCVYOASHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O2S2/c1-14-11-15(2)23-21(22-14)27-13-20(25)24-16-7-9-18(10-8-16)28-19-6-4-5-17(12-19)26-3/h4-12H,13H2,1-3H3,(H,24,25).
What are the key properties of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide?
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide has a molecular weight of 411.55 g/mol, XLogP of 4.98, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[4-(3-methoxyphenyl)sulfanylphenyl]acetamide is sourced from PubChem (CID 155552084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).