C30H23ClF2N4OS2 — CID 155552165
[1-[(2-chlorophenyl)methyl]triazol-4-yl]methyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-oxopiperidine-1-carbodithioate (PubChem CID 155552165) has the molecular formula C30H23ClF2N4OS2 and a molecular weight of 593.12 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methyl]triazol-4-yl]methyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-oxopiperidine-1-carbodithioate.
| Compound Name | [1-[(2-chlorophenyl)methyl]triazol-4-yl]methyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-oxopiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 155552165 |
| Molecular Formula | C30H23ClF2N4OS2 |
| Molecular Weight | 593.12 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | [1-[(2-chlorophenyl)methyl]triazol-4-yl]methyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-oxopiperidine-1-carbodithioate |
| SMILES | O=C1/C(=C/c2ccccc2F)CN(C(=S)SCc2cn(Cc3ccccc3Cl)nn2)C/C1=C\c1ccccc1F |
| InChI | InChI=1S/C30H23ClF2N4OS2/c31-26-10-4-1-9-22(26)17-37-18-25(34-35-37)19-40-30(39)36-15-23(13-20-7-2-5-11-27(20)32)29(38)24(16-36)14-21-8-3-6-12-28(21)33/h1-14,18H,15-17,19H2/b23-13+,24-14+ |
| InChIKey | WWTBYYZBQHMYCW-RNIAWFEPSA-N |
| XLogP | 6.83 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.12 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|