C21H16F2N6O3 — CID 155552200
2,6-difluoro-3-[(2-methoxyphenyl)diazenyl]-N-(3-methoxy-1H-pyrazolo[5,4-b]pyridin-5-yl)benzamide (PubChem CID 155552200) has the molecular formula C21H16F2N6O3 and a molecular weight of 438.39 g/mol. Its IUPAC name is 2,6-difluoro-3-[(2-methoxyphenyl)diazenyl]-N-(3-methoxy-1H-pyrazolo[5,4-b]pyridin-5-yl)benzamide.
| Compound Name | 2,6-difluoro-3-[(2-methoxyphenyl)diazenyl]-N-(3-methoxy-1H-pyrazolo[5,4-b]pyridin-5-yl)benzamide |
|---|---|
| PubChem CID | 155552200 |
| Molecular Formula | C21H16F2N6O3 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2,6-difluoro-3-[(2-methoxyphenyl)diazenyl]-N-(3-methoxy-1H-pyrazolo[5,4-b]pyridin-5-yl)benzamide |
| SMILES | COc1ccccc1/N=N/c1ccc(F)c(C(=O)Nc2cnc3[nH]nc(OC)c3c2)c1F |
| InChI | InChI=1S/C21H16F2N6O3/c1-31-16-6-4-3-5-14(16)26-27-15-8-7-13(22)17(18(15)23)20(30)25-11-9-12-19(24-10-11)28-29-21(12)32-2/h3-10H,1-2H3,(H,25,30)(H,24,28,29)/b27-26+ |
| InChIKey | UVHOEUNRULJPLG-CYYJNZCTSA-N |
| XLogP | 4.92 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|