C18H29N3O6S3 — CID 155552280
methanesulfonic acid;3-N,3-N,7-N,7-N-tetramethyl-10,10a-dihydro-3H-phenothiazine-3,7-diamine (PubChem CID 155552280) has the molecular formula C18H29N3O6S3 and a molecular weight of 479.65 g/mol. Its IUPAC name is methanesulfonic acid;3-N,3-N,7-N,7-N-tetramethyl-10,10a-dihydro-3H-phenothiazine-3,7-diamine.
| Compound Name | methanesulfonic acid;3-N,3-N,7-N,7-N-tetramethyl-10,10a-dihydro-3H-phenothiazine-3,7-diamine |
|---|---|
| PubChem CID | 155552280 |
| Molecular Formula | C18H29N3O6S3 |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | methanesulfonic acid;3-N,3-N,7-N,7-N-tetramethyl-10,10a-dihydro-3H-phenothiazine-3,7-diamine |
| SMILES | CN(C)c1ccc2c(c1)SC1=CC(N(C)C)C=CC1N2.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C16H21N3S.2CH4O3S/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;2*1-5(2,3)4/h5-11,13,17H,1-4H3;2*1H3,(H,2,3,4) |
| InChIKey | XEENBSUEYQLAGA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|