About N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine
N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine (PubChem CID 155552281) has the molecular formula C20H17ClN2O
and a molecular weight of 336.82 g/mol. Its IUPAC name is N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine.
Molecular Properties
| Compound Name | N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine |
| PubChem CID | 155552281 |
| Molecular Formula | C20H17ClN2O |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine |
| SMILES | Clc1cccc(-c2cc(CNc3cccnc3)cc3c2OCC3)c1 |
| InChI | InChI=1S/C20H17ClN2O/c21-17-4-1-3-15(11-17)19-10-14(9-16-6-8-24-20(16)19)12-23-18-5-2-7-22-13-18/h1-5,7,9-11,13,23H,6,8,12H2 |
| InChIKey | MGVARZGXPCNAES-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine?
The IUPAC name of N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine (CID 155552281) is N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine.
What is the SMILES notation for N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine?
The canonical SMILES for N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine is Clc1cccc(-c2cc(CNc3cccnc3)cc3c2OCC3)c1.
What is the InChIKey of N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine?
The InChIKey is MGVARZGXPCNAES-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN2O/c21-17-4-1-3-15(11-17)19-10-14(9-16-6-8-24-20(16)19)12-23-18-5-2-7-22-13-18/h1-5,7,9-11,13,23H,6,8,12H2.
What are the key properties of N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine?
N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine has a molecular weight of 336.82 g/mol, XLogP of 4.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[7-(3-chlorophenyl)-2,3-dihydro-1-benzofuran-5-yl]methyl]pyridin-3-amine is sourced from PubChem (CID 155552281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).