About 4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol
4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol (PubChem CID 155552326) has the molecular formula C20H17F3N2O
and a molecular weight of 358.36 g/mol. Its IUPAC name is 4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol |
| PubChem CID | 155552326 |
| Molecular Formula | C20H17F3N2O |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(-c2cnc(N)c(-c3cccc(C(F)(F)F)c3)c2)cc(C)c1O |
| InChI | InChI=1S/C20H17F3N2O/c1-11-6-14(7-12(2)18(11)26)15-9-17(19(24)25-10-15)13-4-3-5-16(8-13)20(21,22)23/h3-10,26H,1-2H3,(H2,24,25) |
| InChIKey | LKFKDWYIYPAZOZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol?
The IUPAC name of 4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol (CID 155552326) is 4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol.
What is the SMILES notation for 4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol?
The canonical SMILES for 4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol is Cc1cc(-c2cnc(N)c(-c3cccc(C(F)(F)F)c3)c2)cc(C)c1O.
What is the InChIKey of 4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol?
The InChIKey is LKFKDWYIYPAZOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F3N2O/c1-11-6-14(7-12(2)18(11)26)15-9-17(19(24)25-10-15)13-4-3-5-16(8-13)20(21,22)23/h3-10,26H,1-2H3,(H2,24,25).
What are the key properties of 4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol?
4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol has a molecular weight of 358.36 g/mol, XLogP of 5.34, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]-2,6-dimethylphenol is sourced from PubChem (CID 155552326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).