About 5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine
5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine (PubChem CID 155552377) has the molecular formula C18H18ClN3O3
and a molecular weight of 359.81 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine |
| PubChem CID | 155552377 |
| Molecular Formula | C18H18ClN3O3 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine |
| SMILES | COc1cc(-c2nc(N)[nH]c2-c2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H18ClN3O3/c1-23-13-8-11(9-14(24-2)17(13)25-3)16-15(21-18(20)22-16)10-4-6-12(19)7-5-10/h4-9H,1-3H3,(H3,20,21,22) |
| InChIKey | OWOGEJVWDDISPS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine?
The IUPAC name of 5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine (CID 155552377) is 5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine.
What is the SMILES notation for 5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine?
The canonical SMILES for 5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine is COc1cc(-c2nc(N)[nH]c2-c2ccc(Cl)cc2)cc(OC)c1OC.
What is the InChIKey of 5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine?
The InChIKey is OWOGEJVWDDISPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClN3O3/c1-23-13-8-11(9-14(24-2)17(13)25-3)16-15(21-18(20)22-16)10-4-6-12(19)7-5-10/h4-9H,1-3H3,(H3,20,21,22).
What are the key properties of 5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine?
5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine has a molecular weight of 359.81 g/mol, XLogP of 4.01, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-amine is sourced from PubChem (CID 155552377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).