C35H47N7O — CID 155552465
4-(cyclohexylamino)-1-ethyl-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 155552465) has the molecular formula C35H47N7O and a molecular weight of 581.81 g/mol. Its IUPAC name is 4-(cyclohexylamino)-1-ethyl-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 4-(cyclohexylamino)-1-ethyl-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 155552465 |
| Molecular Formula | C35H47N7O |
| Molecular Weight | 581.81 g/mol |
| Exact Mass | 581.38 |
| IUPAC Name | 4-(cyclohexylamino)-1-ethyl-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCn1ncc2c(NC3CCCCC3)c(C(=O)NCCCCCCCNc3c4c(nc5ccccc35)CCCC4)cnc21 |
| InChI | InChI=1S/C35H47N7O/c1-2-42-34-28(24-39-42)33(40-25-15-7-6-8-16-25)29(23-38-34)35(43)37-22-14-5-3-4-13-21-36-32-26-17-9-11-19-30(26)41-31-20-12-10-18-27(31)32/h9,11,17,19,23-25H,2-8,10,12-16,18,20-22H2,1H3,(H,36,41)(H,37,43)(H,38,40) |
| InChIKey | MXLBGHWQAVPECV-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.81 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|