C17H10Cl4N2OS — CID 155552510
2-chloro-N-[4-methyl-3-(2,4,5-trichlorophenyl)-1,3-thiazol-2-ylidene]benzamide (PubChem CID 155552510) has the molecular formula C17H10Cl4N2OS and a molecular weight of 432.16 g/mol. Its IUPAC name is 2-chloro-N-[4-methyl-3-(2,4,5-trichlorophenyl)-1,3-thiazol-2-ylidene]benzamide.
| Compound Name | 2-chloro-N-[4-methyl-3-(2,4,5-trichlorophenyl)-1,3-thiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 155552510 |
| Molecular Formula | C17H10Cl4N2OS |
| Molecular Weight | 432.16 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | 2-chloro-N-[4-methyl-3-(2,4,5-trichlorophenyl)-1,3-thiazol-2-ylidene]benzamide |
| SMILES | Cc1cs/c(=N\C(=O)c2ccccc2Cl)n1-c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H10Cl4N2OS/c1-9-8-25-17(22-16(24)10-4-2-3-5-11(10)18)23(9)15-7-13(20)12(19)6-14(15)21/h2-8H,1H3/b22-17- |
| InChIKey | CZLBADMAQZVASN-XLNRJJMWSA-N |
| XLogP | 6.20 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.16 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|