C29H38BFO8 — CID 155552544
[(1S,2R,3S,4R,6R,7R,8R,14R)-3-hydroxy-2,4,7,14-tetramethyl-4-[(2R)-oxiran-2-yl]-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate (PubChem CID 155552544) has the molecular formula C29H38BFO8 and a molecular weight of 544.43 g/mol. Its IUPAC name is [(1S,2R,3S,4R,6R,7R,8R,14R)-3-hydroxy-2,4,7,14-tetramethyl-4-[(2R)-oxiran-2-yl]-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate.
| Compound Name | [(1S,2R,3S,4R,6R,7R,8R,14R)-3-hydroxy-2,4,7,14-tetramethyl-4-[(2R)-oxiran-2-yl]-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate |
|---|---|
| PubChem CID | 155552544 |
| Molecular Formula | C29H38BFO8 |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | [(1S,2R,3S,4R,6R,7R,8R,14R)-3-hydroxy-2,4,7,14-tetramethyl-4-[(2R)-oxiran-2-yl]-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate |
| SMILES | C[C@@H]1CC[C@@]23CCC(=O)[C@H]2[C@]1(C)[C@H](OC(=O)COc1ccc2c(c1F)B(O)OC2)C[C@@](C)([C@@H]1CO1)[C@@H](O)[C@@H]3C |
| InChI | InChI=1S/C29H38BFO8/c1-15-7-9-29-10-8-18(32)25(29)28(15,4)20(11-27(3,21-13-37-21)26(34)16(29)2)39-22(33)14-36-19-6-5-17-12-38-30(35)23(17)24(19)31/h5-6,15-16,20-21,25-26,34-35H,7-14H2,1-4H3/t15-,16+,20-,21+,25+,26+,27+,28+,29+/m1/s1 |
| InChIKey | ZWYHLSYMBKTONV-ROUKMFECSA-N |
| XLogP | 2.54 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|