C23H25F4N3Si — CID 155552587
1-[[1-(4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane (PubChem CID 155552587) has the molecular formula C23H25F4N3Si and a molecular weight of 447.55 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane.
| Compound Name | 1-[[1-(4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane |
|---|---|
| PubChem CID | 155552587 |
| Molecular Formula | C23H25F4N3Si |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane |
| SMILES | C[Si]1(C)CCN(Cc2cc(-c3ccc(C(F)(F)F)cc3)n(-c3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C23H25F4N3Si/c1-31(2)13-11-29(12-14-31)16-20-15-22(17-3-5-18(6-4-17)23(25,26)27)30(28-20)21-9-7-19(24)8-10-21/h3-10,15H,11-14,16H2,1-2H3 |
| InChIKey | CSFRLWOWNMLPSD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|