C23H29NO3 — CID 155552631
(3E,5E,7E,9S,10R,11Z,13E,15E,17Z,19Z,21S)-9,10-dihydroxy-7,21-dimethyl-1-azacyclodocosa-3,5,7,11,13,15,17,19-octaen-2-one (PubChem CID 155552631) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (3E,5E,7E,9S,10R,11Z,13E,15E,17Z,19Z,21S)-9,10-dihydroxy-7,21-dimethyl-1-azacyclodocosa-3,5,7,11,13,15,17,19-octaen-2-one.
| Compound Name | (3E,5E,7E,9S,10R,11Z,13E,15E,17Z,19Z,21S)-9,10-dihydroxy-7,21-dimethyl-1-azacyclodocosa-3,5,7,11,13,15,17,19-octaen-2-one |
|---|---|
| PubChem CID | 155552631 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (3E,5E,7E,9S,10R,11Z,13E,15E,17Z,19Z,21S)-9,10-dihydroxy-7,21-dimethyl-1-azacyclodocosa-3,5,7,11,13,15,17,19-octaen-2-one |
| SMILES | CC1=C\[C@H](O)[C@H](O)/C=C\C=C\C=C\C=C\C=C/[C@H](C)CNC(=O)/C=C\C=C\1 |
| InChI | InChI=1S/C23H29NO3/c1-19-13-11-12-16-23(27)24-18-20(2)14-9-7-5-3-4-6-8-10-15-21(25)22(26)17-19/h3-17,20-22,25-26H,18H2,1-2H3,(H,24,27)/b4-3+,7-5+,8-6+,13-11+,14-9-,15-10-,16-12+,19-17+/t20-,21+,22-/m0/s1 |
| InChIKey | UCCPCDUFJCGUEI-HZWIWOCBSA-N |
| XLogP | 3.31 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |