C30H22N6O5 — CID 155552685
methyl (1S,12R)-10-[5-(1H-indole-2-carbonylamino)-1H-indole-2-carbonyl]-7-oxo-3,5,10-triazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),4,8-triene-4-carboxylate (PubChem CID 155552685) has the molecular formula C30H22N6O5 and a molecular weight of 546.54 g/mol. Its IUPAC name is methyl (1S,12R)-10-[5-(1H-indole-2-carbonylamino)-1H-indole-2-carbonyl]-7-oxo-3,5,10-triazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),4,8-triene-4-carboxylate.
| Compound Name | methyl (1S,12R)-10-[5-(1H-indole-2-carbonylamino)-1H-indole-2-carbonyl]-7-oxo-3,5,10-triazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),4,8-triene-4-carboxylate |
|---|---|
| PubChem CID | 155552685 |
| Molecular Formula | C30H22N6O5 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | methyl (1S,12R)-10-[5-(1H-indole-2-carbonylamino)-1H-indole-2-carbonyl]-7-oxo-3,5,10-triazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),4,8-triene-4-carboxylate |
| SMILES | COC(=O)c1nc2c([nH]1)[C@]13C[C@H]1CN(C(=O)c1cc4cc(NC(=O)c5cc6ccccc6[nH]5)ccc4[nH]1)C3=CC2=O |
| InChI | InChI=1S/C30H22N6O5/c1-41-29(40)26-34-24-22(37)11-23-30(25(24)35-26)12-16(30)13-36(23)28(39)21-10-15-8-17(6-7-19(15)33-21)31-27(38)20-9-14-4-2-3-5-18(14)32-20/h2-11,16,32-33H,12-13H2,1H3,(H,31,38)(H,34,35)/t16-,30+/m0/s1 |
| InChIKey | QMKQWPVSOOZDGB-BEIWTESXSA-N |
| XLogP | 3.91 |
| TPSA | 153.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |