C14H11N3OS2 — CID 155552838
6-phenyl-2-prop-2-enylsulfanylimidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde (PubChem CID 155552838) has the molecular formula C14H11N3OS2 and a molecular weight of 301.40 g/mol. Its IUPAC name is 6-phenyl-2-prop-2-enylsulfanylimidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde.
| Compound Name | 6-phenyl-2-prop-2-enylsulfanylimidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 155552838 |
| Molecular Formula | C14H11N3OS2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 6-phenyl-2-prop-2-enylsulfanylimidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
| SMILES | C=CCSc1nn2c(C=O)c(-c3ccccc3)nc2s1 |
| InChI | InChI=1S/C14H11N3OS2/c1-2-8-19-14-16-17-11(9-18)12(15-13(17)20-14)10-6-4-3-5-7-10/h2-7,9H,1,8H2 |
| InChIKey | ZICYTYKTNALMKV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|