C16H18N2O2 — CID 155552861
methyl 4-[3-(6-methyl-2-pyridinyl)prop-2-ynylidene]piperidine-1-carboxylate (PubChem CID 155552861) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is methyl 4-[3-(6-methyl-2-pyridinyl)prop-2-ynylidene]piperidine-1-carboxylate.
| Compound Name | methyl 4-[3-(6-methyl-2-pyridinyl)prop-2-ynylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155552861 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | methyl 4-[3-(6-methyl-2-pyridinyl)prop-2-ynylidene]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(=CC#Cc2cccc(C)n2)CC1 |
| InChI | InChI=1S/C16H18N2O2/c1-13-5-3-7-15(17-13)8-4-6-14-9-11-18(12-10-14)16(19)20-2/h3,5-7H,9-12H2,1-2H3 |
| InChIKey | QCFZBCARLHWRGF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|