About 4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide
4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide (PubChem CID 155552878) has the molecular formula C21H17ClN4O
and a molecular weight of 376.85 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide |
| PubChem CID | 155552878 |
| Molecular Formula | C21H17ClN4O |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2ccnc3n[nH]c(-c4ccc(Cl)cc4)c23)cc1 |
| InChI | InChI=1S/C21H17ClN4O/c1-26(2)21(27)15-5-3-13(4-6-15)17-11-12-23-20-18(17)19(24-25-20)14-7-9-16(22)10-8-14/h3-12H,1-2H3,(H,23,24,25) |
| InChIKey | JTUNDPGYBIRPIG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide?
The IUPAC name of 4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide (CID 155552878) is 4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide.
What is the SMILES notation for 4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide?
The canonical SMILES for 4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide is CN(C)C(=O)c1ccc(-c2ccnc3n[nH]c(-c4ccc(Cl)cc4)c23)cc1.
What is the InChIKey of 4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide?
The InChIKey is JTUNDPGYBIRPIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClN4O/c1-26(2)21(27)15-5-3-13(4-6-15)17-11-12-23-20-18(17)19(24-25-20)14-7-9-16(22)10-8-14/h3-12H,1-2H3,(H,23,24,25).
What are the key properties of 4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide?
4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide has a molecular weight of 376.85 g/mol, XLogP of 4.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]-N,N-dimethylbenzamide is sourced from PubChem (CID 155552878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).