C24H22F6O4 — CID 155552998
[(4R,5E,8S,9S)-5-methyl-11-oxo-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),5-dien-4-yl] 3,5-bis(trifluoromethyl)benzoate (PubChem CID 155552998) has the molecular formula C24H22F6O4 and a molecular weight of 488.42 g/mol. Its IUPAC name is [(4R,5E,8S,9S)-5-methyl-11-oxo-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),5-dien-4-yl] 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | [(4R,5E,8S,9S)-5-methyl-11-oxo-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),5-dien-4-yl] 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 155552998 |
| Molecular Formula | C24H22F6O4 |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [(4R,5E,8S,9S)-5-methyl-11-oxo-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),5-dien-4-yl] 3,5-bis(trifluoromethyl)benzoate |
| SMILES | C=C(C)[C@@H]1C/C=C(\C)[C@H](OC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCC2=C[C@@H]1OC2=O |
| InChI | InChI=1S/C24H22F6O4/c1-12(2)18-6-4-13(3)19(7-5-14-10-20(18)34-21(14)31)33-22(32)15-8-16(23(25,26)27)11-17(9-15)24(28,29)30/h4,8-11,18-20H,1,5-7H2,2-3H3/b13-4+/t18-,19+,20-/m0/s1 |
| InChIKey | FSBSFMHBVGGKLN-NVIKZXAWSA-N |
| XLogP | 6.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|