C16H21FN4O — CID 155553076
5-fluoro-2-(1-propan-2-ylpiperidin-3-yl)-1H-benzimidazole-4-carboxamide (PubChem CID 155553076) has the molecular formula C16H21FN4O and a molecular weight of 304.37 g/mol. Its IUPAC name is 5-fluoro-2-(1-propan-2-ylpiperidin-3-yl)-1H-benzimidazole-4-carboxamide.
| Compound Name | 5-fluoro-2-(1-propan-2-ylpiperidin-3-yl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 155553076 |
| Molecular Formula | C16H21FN4O |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 5-fluoro-2-(1-propan-2-ylpiperidin-3-yl)-1H-benzimidazole-4-carboxamide |
| SMILES | CC(C)N1CCCC(c2nc3c(C(N)=O)c(F)ccc3[nH]2)C1 |
| InChI | InChI=1S/C16H21FN4O/c1-9(2)21-7-3-4-10(8-21)16-19-12-6-5-11(17)13(15(18)22)14(12)20-16/h5-6,9-10H,3-4,7-8H2,1-2H3,(H2,18,22)(H,19,20) |
| InChIKey | DQOKTEXAWDTXAI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |