C24H24N4O6 — CID 155553192
3,4-dimethoxy-N-[2-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]benzamide (PubChem CID 155553192) has the molecular formula C24H24N4O6 and a molecular weight of 464.48 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]benzamide |
|---|---|
| PubChem CID | 155553192 |
| Molecular Formula | C24H24N4O6 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 3,4-dimethoxy-N-[2-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3nc(-c4cc(OC)c(OC)c(OC)c4)nn3c2)cc1OC |
| InChI | InChI=1S/C24H24N4O6/c1-30-17-8-6-14(10-18(17)31-2)24(29)25-16-7-9-21-26-23(27-28(21)13-16)15-11-19(32-3)22(34-5)20(12-15)33-4/h6-13H,1-5H3,(H,25,29) |
| InChIKey | DPLAASBQMSTGGS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |