C23H22O6 — CID 155553216
17,17-dimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),6,11-triene-5,8,10,14-tetrone (PubChem CID 155553216) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is 17,17-dimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),6,11-triene-5,8,10,14-tetrone.
| Compound Name | 17,17-dimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),6,11-triene-5,8,10,14-tetrone |
|---|---|
| PubChem CID | 155553216 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 17,17-dimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),6,11-triene-5,8,10,14-tetrone |
| SMILES | CC(C)=CCC12OC(C)(C)C3CC(C=C4C(=O)C5=C(OC431)C(=O)C=CC5=O)C2=O |
| InChI | InChI=1S/C23H22O6/c1-11(2)7-8-22-20(27)12-9-13-18(26)17-14(24)5-6-15(25)19(17)28-23(13,22)16(10-12)21(3,4)29-22/h5-7,9,12,16H,8,10H2,1-4H3 |
| InChIKey | GNVQDZHEAJNEMV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|