About [(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride
[(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride (PubChem CID 155553234) has the molecular formula C10H12Cl2FN
and a molecular weight of 236.12 g/mol. Its IUPAC name is [(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride |
| PubChem CID | 155553234 |
| Molecular Formula | C10H12Cl2FN |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | [(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride |
| SMILES | Cl.NC[C@@H]1C[C@@]1(F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H11ClFN.ClH/c11-9-3-1-2-7(4-9)10(12)5-8(10)6-13;/h1-4,8H,5-6,13H2;1H/t8-,10+;/m0./s1 |
| InChIKey | KVNKDSQPWALVKE-KXNXZCPBSA-N |
| XLogP | 2.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride?
The IUPAC name of [(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride (CID 155553234) is [(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride.
What is the SMILES notation for [(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride?
The canonical SMILES for [(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride is Cl.NC[C@@H]1C[C@@]1(F)c1cccc(Cl)c1.
What is the InChIKey of [(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride?
The InChIKey is KVNKDSQPWALVKE-KXNXZCPBSA-N. The full InChI is InChI=1S/C10H11ClFN.ClH/c11-9-3-1-2-7(4-9)10(12)5-8(10)6-13;/h1-4,8H,5-6,13H2;1H/t8-,10+;/m0./s1.
What are the key properties of [(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride?
[(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride has a molecular weight of 236.12 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-(3-chlorophenyl)-2-fluorocyclopropyl]methanamine;hydrochloride is sourced from PubChem (CID 155553234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).