C41H44ClN5O5 — CID 155553262
CID 155553262 (PubChem CID 155553262) has the molecular formula C41H44ClN5O5 and a molecular weight of 722.29 g/mol.
| Compound Name | CID 155553262 |
|---|---|
| PubChem CID | 155553262 |
| Molecular Formula | C41H44ClN5O5 |
| Molecular Weight | 722.29 g/mol |
| Exact Mass | 721.30 |
| IUPAC Name | — |
| SMILES | O=C1CCC(N2Cc3c(CCCCCNC(=O)[C@@H]4NC5(CCCCC5)[C@@]5(C(=O)Nc6cc(Cl)ccc65)[C@H]4c4ccccc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C41H44ClN5O5/c42-27-16-17-30-31(23-27)44-39(52)41(30)34(26-12-4-1-5-13-26)35(46-40(41)20-7-3-8-21-40)37(50)43-22-9-2-6-11-25-14-10-15-28-29(25)24-47(38(28)51)32-18-19-33(48)45-36(32)49/h1,4-5,10,12-17,23,32,34-35,46H,2-3,6-9,11,18-22,24H2,(H,43,50)(H,44,52)(H,45,48,49)/t32?,34-,35+,41+/m0/s1 |
| InChIKey | WWLNINGKWIULEZ-UWGISFBZSA-N |
| XLogP | 5.28 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.29 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|