C10H7ClF3N5O3S2 — CID 155553361
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 155553361) has the molecular formula C10H7ClF3N5O3S2 and a molecular weight of 401.78 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 155553361 |
| Molecular Formula | C10H7ClF3N5O3S2 |
| Molecular Weight | 401.78 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | NS(=O)(=O)c1nnc(NC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C10H7ClF3N5O3S2/c11-6-2-1-4(3-5(6)10(12,13)14)16-7(20)17-8-18-19-9(23-8)24(15,21)22/h1-3H,(H2,15,21,22)(H2,16,17,18,20) |
| InChIKey | VGELKXWRRBSONO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.78 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|