C17H18N6 — CID 155553420
6-[2-(aminomethyl)phenyl]-2-N-benzyl-1,3,5-triazine-2,4-diamine (PubChem CID 155553420) has the molecular formula C17H18N6 and a molecular weight of 306.37 g/mol. Its IUPAC name is 6-[2-(aminomethyl)phenyl]-2-N-benzyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[2-(aminomethyl)phenyl]-2-N-benzyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 155553420 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 6-[2-(aminomethyl)phenyl]-2-N-benzyl-1,3,5-triazine-2,4-diamine |
| SMILES | NCc1ccccc1-c1nc(N)nc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C17H18N6/c18-10-13-8-4-5-9-14(13)15-21-16(19)23-17(22-15)20-11-12-6-2-1-3-7-12/h1-9H,10-11,18H2,(H3,19,20,21,22,23) |
| InChIKey | BAQJJNQZLFDCOH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |