About CID 155553504
CID 155553504 (PubChem CID 155553504) has the molecular formula C36H32Cl2FN5O5
and a molecular weight of 704.59 g/mol.
Molecular Properties
| Compound Name | CID 155553504 |
| PubChem CID | 155553504 |
| Molecular Formula | C36H32Cl2FN5O5 |
| Molecular Weight | 704.59 g/mol |
| Exact Mass | 703.18 |
| IUPAC Name | — |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)[C@@H]4NC5(CCCCC5)[C@@]5(C(=O)Nc6cc(Cl)ccc65)[C@H]4c4cccc(Cl)c4F)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C36H32Cl2FN5O5/c37-18-10-11-22-25(16-18)41-34(49)36(22)28(20-7-4-8-23(38)29(20)39)30(43-35(36)14-2-1-3-15-35)32(47)40-24-9-5-6-19-21(24)17-44(33(19)48)26-12-13-27(45)42-31(26)46/h4-11,16,26,28,30,43H,1-3,12-15,17H2,(H,40,47)(H,41,49)(H,42,45,46)/t26?,28-,30+,36+/m0/s1 |
| InChIKey | KQSXPGPHCYWVSH-GLRCULSHSA-N |
| XLogP | 5.18 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 704.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 155553504 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155553504?
The IUPAC name of CID 155553504 (CID 155553504) is not available.
What is the SMILES notation for CID 155553504?
The canonical SMILES for CID 155553504 is O=C1CCC(N2Cc3c(NC(=O)[C@@H]4NC5(CCCCC5)[C@@]5(C(=O)Nc6cc(Cl)ccc65)[C@H]4c4cccc(Cl)c4F)cccc3C2=O)C(=O)N1.
What is the InChIKey of CID 155553504?
The InChIKey is KQSXPGPHCYWVSH-GLRCULSHSA-N. The full InChI is InChI=1S/C36H32Cl2FN5O5/c37-18-10-11-22-25(16-18)41-34(49)36(22)28(20-7-4-8-23(38)29(20)39)30(43-35(36)14-2-1-3-15-35)32(47)40-24-9-5-6-19-21(24)17-44(33(19)48)26-12-13-27(45)42-31(26)46/h4-11,16,26,28,30,43H,1-3,12-15,17H2,(H,40,47)(H,41,49)(H,42,45,46)/t26?,28-,30+,36+/m0/s1.
What are the key properties of CID 155553504?
CID 155553504 has a molecular weight of 704.59 g/mol, XLogP of 5.18, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155553504 is sourced from PubChem (CID 155553504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).