C26H19N2O7+ — CID 155553554
(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) 4-nitrobenzoate (PubChem CID 155553554) has the molecular formula C26H19N2O7+ and a molecular weight of 471.45 g/mol. Its IUPAC name is (17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) 4-nitrobenzoate.
| Compound Name | (17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) 4-nitrobenzoate |
|---|---|
| PubChem CID | 155553554 |
| Molecular Formula | C26H19N2O7+ |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | (17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) 4-nitrobenzoate |
| SMILES | COc1ccc2cc3[n+](cc2c1OC(=O)c1ccc([N+](=O)[O-])cc1)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C26H19N2O7/c1-32-22-7-4-16-10-21-19-12-24-23(33-14-34-24)11-17(19)8-9-27(21)13-20(16)25(22)35-26(29)15-2-5-18(6-3-15)28(30)31/h2-7,10-13H,8-9,14H2,1H3/q+1 |
| InChIKey | UIFHWXZTKOJFSO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 101.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|