C32H38N6O3S2 — CID 155553584
3-(2-methoxyethylamino)-N-[3-[5-[3-(4-methylpiperazine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide (PubChem CID 155553584) has the molecular formula C32H38N6O3S2 and a molecular weight of 618.83 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-N-[3-[5-[3-(4-methylpiperazine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide.
| Compound Name | 3-(2-methoxyethylamino)-N-[3-[5-[3-(4-methylpiperazine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 155553584 |
| Molecular Formula | C32H38N6O3S2 |
| Molecular Weight | 618.83 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | 3-(2-methoxyethylamino)-N-[3-[5-[3-(4-methylpiperazine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4cccc(C(=O)N5CCN(C)CC5)c4)ccc3s1)CCNC2 |
| InChI | InChI=1S/C32H38N6O3S2/c1-37-13-15-38(16-14-37)32(40)23-5-3-4-21(18-23)22-6-7-26-25(19-22)35-30(42-26)29-24-8-10-34-20-27(24)43-31(29)36-28(39)9-11-33-12-17-41-2/h3-7,18-19,33-34H,8-17,20H2,1-2H3,(H,36,39) |
| InChIKey | DIXSESDBNHXGFA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.83 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|