C27H31NO5 — CID 155553686
(1R,2E,4E,5S)-2,4-bis[(3,4-dimethoxyphenyl)methylidene]-8-ethyl-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 155553686) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is (1R,2E,4E,5S)-2,4-bis[(3,4-dimethoxyphenyl)methylidene]-8-ethyl-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,2E,4E,5S)-2,4-bis[(3,4-dimethoxyphenyl)methylidene]-8-ethyl-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 155553686 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (1R,2E,4E,5S)-2,4-bis[(3,4-dimethoxyphenyl)methylidene]-8-ethyl-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | CCN1[C@@H]2CC[C@H]1/C(=C\c1ccc(OC)c(OC)c1)C(=O)/C2=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H31NO5/c1-6-28-21-9-10-22(28)20(14-18-8-12-24(31-3)26(16-18)33-5)27(29)19(21)13-17-7-11-23(30-2)25(15-17)32-4/h7-8,11-16,21-22H,6,9-10H2,1-5H3/b19-13+,20-14+/t21-,22+ |
| InChIKey | UWOXCQIAKONBFZ-BNPHYSGUSA-N |
| XLogP | 4.62 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|