About 1,5-dimethyl-4a,8a-dihydronaphthalene
1,5-dimethyl-4a,8a-dihydronaphthalene (PubChem CID 15555373) has the molecular formula C12H14
and a molecular weight of 158.24 g/mol. Its IUPAC name is 1,5-dimethyl-4a,8a-dihydronaphthalene.
Molecular Properties
| Compound Name | 1,5-dimethyl-4a,8a-dihydronaphthalene |
| PubChem CID | 15555373 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 1,5-dimethyl-4a,8a-dihydronaphthalene |
| SMILES | CC1=CC=CC2C(C)=CC=CC12 |
| InChI | InChI=1S/C12H14/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h3-8,11-12H,1-2H3 |
| InChIKey | IPJOIHQXCRULOK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,5-dimethyl-4a,8a-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-4a,8a-dihydronaphthalene?
The IUPAC name of 1,5-dimethyl-4a,8a-dihydronaphthalene (CID 15555373) is 1,5-dimethyl-4a,8a-dihydronaphthalene.
What is the SMILES notation for 1,5-dimethyl-4a,8a-dihydronaphthalene?
The canonical SMILES for 1,5-dimethyl-4a,8a-dihydronaphthalene is CC1=CC=CC2C(C)=CC=CC12.
What is the InChIKey of 1,5-dimethyl-4a,8a-dihydronaphthalene?
The InChIKey is IPJOIHQXCRULOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h3-8,11-12H,1-2H3.
What are the key properties of 1,5-dimethyl-4a,8a-dihydronaphthalene?
1,5-dimethyl-4a,8a-dihydronaphthalene has a molecular weight of 158.24 g/mol, XLogP of 3.25, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-4a,8a-dihydronaphthalene is sourced from PubChem (CID 15555373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).