C42H52O7 — CID 155553978
3-[3-[(Z)-3-methoxy-3-oxoprop-1-enyl]phenoxy]propyl (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate (PubChem CID 155553978) has the molecular formula C42H52O7 and a molecular weight of 668.87 g/mol. Its IUPAC name is 3-[3-[(Z)-3-methoxy-3-oxoprop-1-enyl]phenoxy]propyl (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate.
| Compound Name | 3-[3-[(Z)-3-methoxy-3-oxoprop-1-enyl]phenoxy]propyl (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
|---|---|
| PubChem CID | 155553978 |
| Molecular Formula | C42H52O7 |
| Molecular Weight | 668.87 g/mol |
| Exact Mass | 668.37 |
| IUPAC Name | 3-[3-[(Z)-3-methoxy-3-oxoprop-1-enyl]phenoxy]propyl (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
| SMILES | COC(=O)/C=C\c1cccc(OCCCOC(=O)[C@]2(C)CC[C@]3(C)CC[C@]4(C)C5=CC=C6C(=CC(=O)C(O)=C6C)[C@]5(C)CC[C@@]4(C)[C@@H]3C2)c1 |
| InChI | InChI=1S/C42H52O7/c1-27-30-13-14-33-40(4,31(30)25-32(43)36(27)45)19-21-42(6)34-26-39(3,17-16-38(34,2)18-20-41(33,42)5)37(46)49-23-9-22-48-29-11-8-10-28(24-29)12-15-35(44)47-7/h8,10-15,24-25,34,45H,9,16-23,26H2,1-7H3/b15-12-/t34-,38-,39-,40+,41-,42+/m1/s1 |
| InChIKey | DXMRCVQHDYTRDN-LXXMRRLYSA-N |
| XLogP | 8.81 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.87 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|