About N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide
N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide (PubChem CID 155554009) has the molecular formula C23H17BrN2O2
and a molecular weight of 433.31 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide.
Molecular Properties
| Compound Name | N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide |
| PubChem CID | 155554009 |
| Molecular Formula | C23H17BrN2O2 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide |
| SMILES | O=C(/C=C/C=C/c1ccncc1)c1ccc(C(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H17BrN2O2/c24-20-9-11-21(12-10-20)26-23(28)19-7-5-18(6-8-19)22(27)4-2-1-3-17-13-15-25-16-14-17/h1-16H,(H,26,28)/b3-1+,4-2+ |
| InChIKey | XMHSHIFRNUYRDA-ZPUQHVIOSA-N |
| XLogP | 5.55 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide?
The IUPAC name of N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide (CID 155554009) is N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide.
What is the SMILES notation for N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide?
The canonical SMILES for N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide is O=C(/C=C/C=C/c1ccncc1)c1ccc(C(=O)Nc2ccc(Br)cc2)cc1.
What is the InChIKey of N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide?
The InChIKey is XMHSHIFRNUYRDA-ZPUQHVIOSA-N. The full InChI is InChI=1S/C23H17BrN2O2/c24-20-9-11-21(12-10-20)26-23(28)19-7-5-18(6-8-19)22(27)4-2-1-3-17-13-15-25-16-14-17/h1-16H,(H,26,28)/b3-1+,4-2+.
What are the key properties of N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide?
N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide has a molecular weight of 433.31 g/mol, XLogP of 5.55, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-4-[(2E,4E)-5-pyridin-4-ylpenta-2,4-dienoyl]benzamide is sourced from PubChem (CID 155554009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).