C38H42BrN3O3 — CID 155554024
(6aR,11bR)-4,9,10-trimethoxy-5-[3-[2-methyl-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide (PubChem CID 155554024) has the molecular formula C38H42BrN3O3 and a molecular weight of 668.68 g/mol. Its IUPAC name is (6aR,11bR)-4,9,10-trimethoxy-5-[3-[2-methyl-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide.
| Compound Name | (6aR,11bR)-4,9,10-trimethoxy-5-[3-[2-methyl-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide |
|---|---|
| PubChem CID | 155554024 |
| Molecular Formula | C38H42BrN3O3 |
| Molecular Weight | 668.68 g/mol |
| Exact Mass | 667.24 |
| IUPAC Name | (6aR,11bR)-4,9,10-trimethoxy-5-[3-[2-methyl-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide |
| SMILES | COc1cc2c(cc1OC)[C@@H]1c3cccc(OC)c3N(CCCn3c(C)[n+](Cc4ccc(C)cc4)c4ccccc43)C[C@@H]1C2.[Br-] |
| InChI | InChI=1S/C38H42N3O3.BrH/c1-25-14-16-27(17-15-25)23-41-26(2)40(32-11-6-7-12-33(32)41)19-9-18-39-24-29-20-28-21-35(43-4)36(44-5)22-31(28)37(29)30-10-8-13-34(42-3)38(30)39;/h6-8,10-17,21-22,29,37H,9,18-20,23-24H2,1-5H3;1H/q+1;/p-1/t29-,37-;/m0./s1 |
| InChIKey | WTWXISZGDFTSFG-FSHYHNLSSA-M |
| XLogP | 3.84 |
| TPSA | 39.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|