C19H19N5O3 — CID 155554029
methyl 2-imidazo[1,2-a]pyridin-6-yl-3-(2-methoxyethylamino)imidazo[1,2-a]pyridine-6-carboxylate (PubChem CID 155554029) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is methyl 2-imidazo[1,2-a]pyridin-6-yl-3-(2-methoxyethylamino)imidazo[1,2-a]pyridine-6-carboxylate.
| Compound Name | methyl 2-imidazo[1,2-a]pyridin-6-yl-3-(2-methoxyethylamino)imidazo[1,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 155554029 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | methyl 2-imidazo[1,2-a]pyridin-6-yl-3-(2-methoxyethylamino)imidazo[1,2-a]pyridine-6-carboxylate |
| SMILES | COCCNc1c(-c2ccc3nccn3c2)nc2ccc(C(=O)OC)cn12 |
| InChI | InChI=1S/C19H19N5O3/c1-26-10-8-21-18-17(13-3-5-15-20-7-9-23(15)11-13)22-16-6-4-14(12-24(16)18)19(25)27-2/h3-7,9,11-12,21H,8,10H2,1-2H3 |
| InChIKey | PFHUCNXKJAUXFJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|