C26H25BrFN5O6S — CID 155554063
[(1R,2R,3S,4R)-4-[[5-[1-[(3-bromophenyl)methyl]-5-fluoroindole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 155554063) has the molecular formula C26H25BrFN5O6S and a molecular weight of 634.48 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[[5-[1-[(3-bromophenyl)methyl]-5-fluoroindole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-4-[[5-[1-[(3-bromophenyl)methyl]-5-fluoroindole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 155554063 |
| Molecular Formula | C26H25BrFN5O6S |
| Molecular Weight | 634.48 g/mol |
| Exact Mass | 633.07 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[[5-[1-[(3-bromophenyl)methyl]-5-fluoroindole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ncncc2C(=O)c2cn(Cc3cccc(Br)c3)c3ccc(F)cc23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H25BrFN5O6S/c27-16-3-1-2-14(6-16)10-33-11-20(18-8-17(28)4-5-22(18)33)24(35)19-9-30-13-31-26(19)32-21-7-15(23(34)25(21)36)12-39-40(29,37)38/h1-6,8-9,11,13,15,21,23,25,34,36H,7,10,12H2,(H2,29,37,38)(H,30,31,32)/t15-,21-,23-,25+/m1/s1 |
| InChIKey | GEVVUAXCPLJANF-KSZWDZKGSA-N |
| XLogP | 2.35 |
| TPSA | 169.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |