C17H13ClN4S — CID 155554200
N-[(4-chlorophenyl)methyl]-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine (PubChem CID 155554200) has the molecular formula C17H13ClN4S and a molecular weight of 340.84 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine |
|---|---|
| PubChem CID | 155554200 |
| Molecular Formula | C17H13ClN4S |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine |
| SMILES | Clc1ccc(CNc2ncc3c(n2)-c2cccnc2SC3)cc1 |
| InChI | InChI=1S/C17H13ClN4S/c18-13-5-3-11(4-6-13)8-20-17-21-9-12-10-23-16-14(15(12)22-17)2-1-7-19-16/h1-7,9H,8,10H2,(H,20,21,22) |
| InChIKey | FKUXRCQPKMQTMD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |