About 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide
4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide (PubChem CID 155554213) has the molecular formula C24H21FN4OS
and a molecular weight of 432.52 g/mol. Its IUPAC name is 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide.
Molecular Properties
| Compound Name | 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide |
| PubChem CID | 155554213 |
| Molecular Formula | C24H21FN4OS |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide |
| SMILES | Cc1nnc(SCc2ccc(C(=O)Nc3ccc(F)cc3)cc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H21FN4OS/c1-17-27-28-24(29(17)15-18-5-3-2-4-6-18)31-16-19-7-9-20(10-8-19)23(30)26-22-13-11-21(25)12-14-22/h2-14H,15-16H2,1H3,(H,26,30) |
| InChIKey | ZFOORHATDWUXCE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide?
The IUPAC name of 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide (CID 155554213) is 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide.
What is the SMILES notation for 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide?
The canonical SMILES for 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide is Cc1nnc(SCc2ccc(C(=O)Nc3ccc(F)cc3)cc2)n1Cc1ccccc1.
What is the InChIKey of 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide?
The InChIKey is ZFOORHATDWUXCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21FN4OS/c1-17-27-28-24(29(17)15-18-5-3-2-4-6-18)31-16-19-7-9-20(10-8-19)23(30)26-22-13-11-21(25)12-14-22/h2-14H,15-16H2,1H3,(H,26,30).
What are the key properties of 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide?
4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide has a molecular weight of 432.52 g/mol, XLogP of 5.32, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-(4-fluorophenyl)benzamide is sourced from PubChem (CID 155554213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).