C19H17N3O3S — CID 155554256
3-thiophen-2-yl-6-(3,4,5-trimethoxyphenyl)imidazo[1,2-b]pyridazine (PubChem CID 155554256) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 3-thiophen-2-yl-6-(3,4,5-trimethoxyphenyl)imidazo[1,2-b]pyridazine.
| Compound Name | 3-thiophen-2-yl-6-(3,4,5-trimethoxyphenyl)imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 155554256 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 3-thiophen-2-yl-6-(3,4,5-trimethoxyphenyl)imidazo[1,2-b]pyridazine |
| SMILES | COc1cc(-c2ccc3ncc(-c4cccs4)n3n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H17N3O3S/c1-23-15-9-12(10-16(24-2)19(15)25-3)13-6-7-18-20-11-14(22(18)21-13)17-5-4-8-26-17/h4-11H,1-3H3 |
| InChIKey | WRJUHSMIBBVAAW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |