About 2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol
2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol (PubChem CID 155554322) has the molecular formula C16H22O3
and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol.
Molecular Properties
| Compound Name | 2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol |
| PubChem CID | 155554322 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol |
| SMILES | CC(C)=CCCC1(C)CC(O)c2cc(O)ccc2O1 |
| InChI | InChI=1S/C16H22O3/c1-11(2)5-4-8-16(3)10-14(18)13-9-12(17)6-7-15(13)19-16/h5-7,9,14,17-18H,4,8,10H2,1-3H3 |
| InChIKey | FNLNSHQXHPOIHX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol?
The IUPAC name of 2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol (CID 155554322) is 2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol.
What is the SMILES notation for 2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol?
The canonical SMILES for 2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol is CC(C)=CCCC1(C)CC(O)c2cc(O)ccc2O1.
What is the InChIKey of 2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol?
The InChIKey is FNLNSHQXHPOIHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3/c1-11(2)5-4-8-16(3)10-14(18)13-9-12(17)6-7-15(13)19-16/h5-7,9,14,17-18H,4,8,10H2,1-3H3.
What are the key properties of 2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol?
2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol has a molecular weight of 262.35 g/mol, XLogP of 3.71, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-4,6-diol is sourced from PubChem (CID 155554322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).