C25H34N8O6 — CID 155554732
(2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[4-(3-carbamoylphenyl)butyl]amino]butanoic acid (PubChem CID 155554732) has the molecular formula C25H34N8O6 and a molecular weight of 542.60 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[4-(3-carbamoylphenyl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[4-(3-carbamoylphenyl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 155554732 |
| Molecular Formula | C25H34N8O6 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[4-(3-carbamoylphenyl)butyl]amino]butanoic acid |
| SMILES | NC(=O)c1cccc(CCCCN(CC[C@H](N)C(=O)O)C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C25H34N8O6/c26-16(25(37)38)7-9-32(8-2-1-4-14-5-3-6-15(10-14)22(28)36)11-17-19(34)20(35)24(39-17)33-13-31-18-21(27)29-12-30-23(18)33/h3,5-6,10,12-13,16-17,19-20,24,34-35H,1-2,4,7-9,11,26H2,(H2,28,36)(H,37,38)(H2,27,29,30)/t16-,17+,19+,20+,24+/m0/s1 |
| InChIKey | MQWNVMPLQQATGE-IKEGABRUSA-N |
| XLogP | -0.75 |
| TPSA | 228.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|