C18H20N8O3S — CID 155554840
1-[4-anilino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(4-sulfamoylphenyl)urea (PubChem CID 155554840) has the molecular formula C18H20N8O3S and a molecular weight of 428.48 g/mol. Its IUPAC name is 1-[4-anilino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-[4-anilino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 155554840 |
| Molecular Formula | C18H20N8O3S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 1-[4-anilino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(4-sulfamoylphenyl)urea |
| SMILES | CN(C)c1nc(NC(=O)Nc2ccc(S(N)(=O)=O)cc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C18H20N8O3S/c1-26(2)17-23-15(20-12-6-4-3-5-7-12)22-16(24-17)25-18(27)21-13-8-10-14(11-9-13)30(19,28)29/h3-11H,1-2H3,(H2,19,28,29)(H3,20,21,22,23,24,25,27) |
| InChIKey | WVUNXAMHZFCUJQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 155.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |