C42H69NO5 — CID 155554895
6-[[(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hexanoyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbonyl]amino]hexanoic acid (PubChem CID 155554895) has the molecular formula C42H69NO5 and a molecular weight of 668.02 g/mol. Its IUPAC name is 6-[[(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hexanoyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hexanoyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 155554895 |
| Molecular Formula | C42H69NO5 |
| Molecular Weight | 668.02 g/mol |
| Exact Mass | 667.52 |
| IUPAC Name | 6-[[(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hexanoyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbonyl]amino]hexanoic acid |
| SMILES | CCCCCC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC=C4[C@@H]5CC(C)(C)CC[C@]5(C(=O)NCCCCCC(=O)O)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C42H69NO5/c1-9-10-12-16-35(46)48-33-20-21-39(6)31(38(33,4)5)19-22-41(8)32(39)18-17-29-30-28-37(2,3)23-25-42(30,26-24-40(29,41)7)36(47)43-27-14-11-13-15-34(44)45/h17,30-33H,9-16,18-28H2,1-8H3,(H,43,47)(H,44,45)/t30-,31-,32+,33-,39-,40+,41+,42-/m0/s1 |
| InChIKey | LFEKWFNNUUKRGN-OETNSKAQSA-N |
| XLogP | 10.04 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.02 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|